About ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate
ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate (PubChem CID 70294559) has the molecular formula C28H29NO6S
and a molecular weight of 507.61 g/mol. Its IUPAC name is ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate |
| PubChem CID | 70294559 |
| Molecular Formula | C28H29NO6S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate |
| SMILES | CCOC(=O)CN(Cc1sc2cc(OC)c(OC)cc2c1Oc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H29NO6S/c1-5-34-27(30)18-29(19-9-7-6-8-10-19)17-26-28(35-21-13-11-20(31-2)12-14-21)22-15-23(32-3)24(33-4)16-25(22)36-26/h6-16H,5,17-18H2,1-4H3 |
| InChIKey | XFIIPDMBSAYALB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate?
The IUPAC name of ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate (CID 70294559) is ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate.
What is the SMILES notation for ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate?
The canonical SMILES for ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate is CCOC(=O)CN(Cc1sc2cc(OC)c(OC)cc2c1Oc1ccc(OC)cc1)c1ccccc1.
What is the InChIKey of ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate?
The InChIKey is XFIIPDMBSAYALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29NO6S/c1-5-34-27(30)18-29(19-9-7-6-8-10-19)17-26-28(35-21-13-11-20(31-2)12-14-21)22-15-23(32-3)24(33-4)16-25(22)36-26/h6-16H,5,17-18H2,1-4H3.
What are the key properties of ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate?
ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate has a molecular weight of 507.61 g/mol, XLogP of 6.29, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[N-[[5,6-dimethoxy-3-(4-methoxyphenoxy)-1-benzothiophen-2-yl]methyl]anilino]acetate is sourced from PubChem (CID 70294559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).