C23H16N4 — CID 702952
2,3,6-triphenylimidazo[1,2-b][1,2,4]triazine (PubChem CID 702952) has the molecular formula C23H16N4 and a molecular weight of 348.41 g/mol. Its IUPAC name is 2,3,6-triphenylimidazo[1,2-b][1,2,4]triazine.
| Compound Name | 2,3,6-triphenylimidazo[1,2-b][1,2,4]triazine |
|---|---|
| PubChem CID | 702952 |
| Molecular Formula | C23H16N4 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2,3,6-triphenylimidazo[1,2-b][1,2,4]triazine |
| SMILES | c1ccc(-c2cn3nc(-c4ccccc4)c(-c4ccccc4)nc3n2)cc1 |
| InChI | InChI=1S/C23H16N4/c1-4-10-17(11-5-1)20-16-27-23(24-20)25-21(18-12-6-2-7-13-18)22(26-27)19-14-8-3-9-15-19/h1-16H |
| InChIKey | CGLIDRNLWKCDLU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |