About 1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid
1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid (PubChem CID 70295264) has the molecular formula C9H14N2O5
and a molecular weight of 230.22 g/mol. Its IUPAC name is 1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid |
| PubChem CID | 70295264 |
| Molecular Formula | C9H14N2O5 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid |
| SMILES | COC(=O)N1CC(C(=O)O)C(C)(C)NC1=O |
| InChI | InChI=1S/C9H14N2O5/c1-9(2)5(6(12)13)4-11(7(14)10-9)8(15)16-3/h5H,4H2,1-3H3,(H,10,14)(H,12,13) |
| InChIKey | MMSNUFFKJPVGCI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid?
The IUPAC name of 1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid (CID 70295264) is 1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid.
What is the SMILES notation for 1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid?
The canonical SMILES for 1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid is COC(=O)N1CC(C(=O)O)C(C)(C)NC1=O.
What is the InChIKey of 1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid?
The InChIKey is MMSNUFFKJPVGCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O5/c1-9(2)5(6(12)13)4-11(7(14)10-9)8(15)16-3/h5H,4H2,1-3H3,(H,10,14)(H,12,13).
What are the key properties of 1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid?
1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid has a molecular weight of 230.22 g/mol, XLogP of 0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxycarbonyl-4,4-dimethyl-2-oxo-1,3-diazinane-5-carboxylic acid is sourced from PubChem (CID 70295264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).