C14H23N3O — CID 7029528
[[(E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-2-enyl]amino]urea (PubChem CID 7029528) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is [[(E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-2-enyl]amino]urea.
| Compound Name | [[(E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-2-enyl]amino]urea |
|---|---|
| PubChem CID | 7029528 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | [[(E)-1-(2,6,6-trimethylcyclohex-2-en-1-ylidene)but-2-enyl]amino]urea |
| SMILES | C/C=C/C(NNC(N)=O)=C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C14H23N3O/c1-5-7-11(16-17-13(15)18)12-10(2)8-6-9-14(12,3)4/h5,7-8,16H,6,9H2,1-4H3,(H3,15,17,18)/b7-5+,12-11? |
| InChIKey | AANRLPBVJUCDIH-WUGHOGASSA-N |
| XLogP | 2.76 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|