C11H17N3O3 — CID 7029530
5-(hexyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7029530) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 5-(hexyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(hexyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7029530 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 5-(hexyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCC/N=C/C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C11H17N3O3/c1-2-3-4-5-6-12-7-8-9(15)13-11(17)14-10(8)16/h7-8H,2-6H2,1H3,(H2,13,14,15,16,17)/b12-7+ |
| InChIKey | UYUHXEGXYHKNSZ-KPKJPENVSA-N |
| XLogP | 0.62 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|