C39H41F2N7O3 — CID 70295357
6-fluoro-N-[4-[6-fluoro-2,4-dioxo-1-[3-[4-[3-(propan-2-ylamino)propyl]phenyl]phenyl]pyrido[2,3-d]pyrimidin-3-yl]cyclohexyl]-2,3-dihydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 70295357) has the molecular formula C39H41F2N7O3 and a molecular weight of 693.80 g/mol. Its IUPAC name is 6-fluoro-N-[4-[6-fluoro-2,4-dioxo-1-[3-[4-[3-(propan-2-ylamino)propyl]phenyl]phenyl]pyrido[2,3-d]pyrimidin-3-yl]cyclohexyl]-2,3-dihydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 6-fluoro-N-[4-[6-fluoro-2,4-dioxo-1-[3-[4-[3-(propan-2-ylamino)propyl]phenyl]phenyl]pyrido[2,3-d]pyrimidin-3-yl]cyclohexyl]-2,3-dihydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 70295357 |
| Molecular Formula | C39H41F2N7O3 |
| Molecular Weight | 693.80 g/mol |
| Exact Mass | 693.32 |
| IUPAC Name | 6-fluoro-N-[4-[6-fluoro-2,4-dioxo-1-[3-[4-[3-(propan-2-ylamino)propyl]phenyl]phenyl]pyrido[2,3-d]pyrimidin-3-yl]cyclohexyl]-2,3-dihydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | CC(C)NCCCc1ccc(-c2cccc(-n3c(=O)n(C4CCC(NC(=O)C5CN6C=C(F)C=CC6=N5)CC4)c(=O)c4cc(F)cnc43)c2)cc1 |
| InChI | InChI=1S/C39H41F2N7O3/c1-24(2)42-18-4-5-25-8-10-26(11-9-25)27-6-3-7-32(19-27)47-36-33(20-29(41)21-43-36)38(50)48(39(47)51)31-15-13-30(14-16-31)44-37(49)34-23-46-22-28(40)12-17-35(46)45-34/h3,6-12,17,19-22,24,30-31,34,42H,4-5,13-16,18,23H2,1-2H3,(H,44,49) |
| InChIKey | OOVSWLFNRBKJGE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.80 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|