C9H17N3O3S — CID 70295860
5-propanoyl-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole-4-sulfonamide (PubChem CID 70295860) has the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. Its IUPAC name is 5-propanoyl-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole-4-sulfonamide.
| Compound Name | 5-propanoyl-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole-4-sulfonamide |
|---|---|
| PubChem CID | 70295860 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 5-propanoyl-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole-4-sulfonamide |
| SMILES | CCC(=O)C1CC2NCCC2N1S(N)(=O)=O |
| InChI | InChI=1S/C9H17N3O3S/c1-2-9(13)8-5-6-7(3-4-11-6)12(8)16(10,14)15/h6-8,11H,2-5H2,1H3,(H2,10,14,15) |
| InChIKey | HWQZEHYLERTCNB-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |