C14H17F5O2Si2 — CID 70295926
[4,4-Difluoro-3-[2-(trifluoromethoxy)phenyl]but-2-en-2-yl]silyloxy-trimethylsilane (PubChem CID 70295926) has the molecular formula C14H17F5O2Si2 and a molecular weight of 368.45 g/mol.
| Compound Name | [4,4-Difluoro-3-[2-(trifluoromethoxy)phenyl]but-2-en-2-yl]silyloxy-trimethylsilane |
|---|---|
| PubChem CID | 70295926 |
| Molecular Formula | C14H17F5O2Si2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | — |
| SMILES | CC([Si]O[Si](C)(C)C)=C(c1ccccc1OC(F)(F)F)C(F)F |
| InChI | InChI=1S/C14H17F5O2Si2/c1-9(22-21-23(2,3)4)12(13(15)16)10-7-5-6-8-11(10)20-14(17,18)19/h5-8,13H,1-4H3 |
| InChIKey | GGFYHOCAURCXAI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|