C13H11NO4 — CID 70296281
5-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]-1,3-oxazolidine-2,4-dione (PubChem CID 70296281) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is 5-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 70296281 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 5-[(2-hydroxy-3-prop-2-enylphenyl)methylidene]-1,3-oxazolidine-2,4-dione |
| SMILES | C=CCc1cccc(C=C2OC(=O)NC2=O)c1O |
| InChI | InChI=1S/C13H11NO4/c1-2-4-8-5-3-6-9(11(8)15)7-10-12(16)14-13(17)18-10/h2-3,5-7,15H,1,4H2,(H,14,16,17) |
| InChIKey | XYFBLTSOYFMBEN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|