About 4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride
4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride (PubChem CID 70296532) has the molecular formula C16H21ClN2O4
and a molecular weight of 340.81 g/mol. Its IUPAC name is 4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride.
Molecular Properties
| Compound Name | 4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride |
| PubChem CID | 70296532 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.Nc1cccc2c1C(=O)N(CCCCCC1OCCO1)C2=O |
| InChI | InChI=1S/C16H20N2O4.ClH/c17-12-6-4-5-11-14(12)16(20)18(15(11)19)8-3-1-2-7-13-21-9-10-22-13;/h4-6,13H,1-3,7-10,17H2;1H |
| InChIKey | BPGPCXWTQSYUCE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride?
The IUPAC name of 4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride (CID 70296532) is 4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride.
What is the SMILES notation for 4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride?
The canonical SMILES for 4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride is Cl.Nc1cccc2c1C(=O)N(CCCCCC1OCCO1)C2=O.
What is the InChIKey of 4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride?
The InChIKey is BPGPCXWTQSYUCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O4.ClH/c17-12-6-4-5-11-14(12)16(20)18(15(11)19)8-3-1-2-7-13-21-9-10-22-13;/h4-6,13H,1-3,7-10,17H2;1H.
What are the key properties of 4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride?
4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride has a molecular weight of 340.81 g/mol, XLogP of 2.22, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-[5-(1,3-dioxolan-2-yl)pentyl]isoindole-1,3-dione;hydrochloride is sourced from PubChem (CID 70296532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).