C17H24O7 — CID 70297931
(1R,4aS,7aR)-7-(2-acetyloxyethyl)-1-(1-ethoxyethoxy)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid (PubChem CID 70297931) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is (1R,4aS,7aR)-7-(2-acetyloxyethyl)-1-(1-ethoxyethoxy)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid.
| Compound Name | (1R,4aS,7aR)-7-(2-acetyloxyethyl)-1-(1-ethoxyethoxy)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid |
|---|---|
| PubChem CID | 70297931 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (1R,4aS,7aR)-7-(2-acetyloxyethyl)-1-(1-ethoxyethoxy)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid |
| SMILES | CCOC(C)O[C@H]1OC=C(C(=O)O)[C@H]2CC=C(CCOC(C)=O)[C@H]12 |
| InChI | InChI=1S/C17H24O7/c1-4-21-11(3)24-17-15-12(7-8-22-10(2)18)5-6-13(15)14(9-23-17)16(19)20/h5,9,11,13,15,17H,4,6-8H2,1-3H3,(H,19,20)/t11?,13-,15+,17-/m1/s1 |
| InChIKey | NUSYSYVENXAITD-BBSRMKRTSA-N |
| XLogP | 2.23 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|