C10H10F4O2 — CID 70298002
1,2-bis(difluoromethoxy)-4-ethylbenzene (PubChem CID 70298002) has the molecular formula C10H10F4O2 and a molecular weight of 238.18 g/mol. Its IUPAC name is 1,2-bis(difluoromethoxy)-4-ethylbenzene.
| Compound Name | 1,2-bis(difluoromethoxy)-4-ethylbenzene |
|---|---|
| PubChem CID | 70298002 |
| Molecular Formula | C10H10F4O2 |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1,2-bis(difluoromethoxy)-4-ethylbenzene |
| SMILES | CCc1ccc(OC(F)F)c(OC(F)F)c1 |
| InChI | InChI=1S/C10H10F4O2/c1-2-6-3-4-7(15-9(11)12)8(5-6)16-10(13)14/h3-5,9-10H,2H2,1H3 |
| InChIKey | VMXYVQITGVARNV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |