C22H23F2N3O2 — CID 70298026
4-(3-but-3-enoxyphenyl)-4-[4-(difluoromethoxy)phenyl]-1-methyl-5-methylideneimidazol-2-amine (PubChem CID 70298026) has the molecular formula C22H23F2N3O2 and a molecular weight of 399.44 g/mol. Its IUPAC name is 4-(3-but-3-enoxyphenyl)-4-[4-(difluoromethoxy)phenyl]-1-methyl-5-methylideneimidazol-2-amine.
| Compound Name | 4-(3-but-3-enoxyphenyl)-4-[4-(difluoromethoxy)phenyl]-1-methyl-5-methylideneimidazol-2-amine |
|---|---|
| PubChem CID | 70298026 |
| Molecular Formula | C22H23F2N3O2 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-(3-but-3-enoxyphenyl)-4-[4-(difluoromethoxy)phenyl]-1-methyl-5-methylideneimidazol-2-amine |
| SMILES | C=CCCOc1cccc(C2(c3ccc(OC(F)F)cc3)N=C(N)N(C)C2=C)c1 |
| InChI | InChI=1S/C22H23F2N3O2/c1-4-5-13-28-19-8-6-7-17(14-19)22(15(2)27(3)21(25)26-22)16-9-11-18(12-10-16)29-20(23)24/h4,6-12,14,20H,1-2,5,13H2,3H3,(H2,25,26) |
| InChIKey | GPJVUBGTDQPUMS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|