About 3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride
3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride (PubChem CID 70298080) has the molecular formula C13H23Cl2N3O
and a molecular weight of 308.25 g/mol. Its IUPAC name is 3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride.
Molecular Properties
| Compound Name | 3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride |
| PubChem CID | 70298080 |
| Molecular Formula | C13H23Cl2N3O |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)CCN1CCC(C2C=CC=CN2)CC1 |
| InChI | InChI=1S/C13H21N3O.2ClH/c14-13(17)6-10-16-8-4-11(5-9-16)12-3-1-2-7-15-12;;/h1-3,7,11-12,15H,4-6,8-10H2,(H2,14,17);2*1H |
| InChIKey | DXPDOLHFPWNPJT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride?
The IUPAC name of 3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride (CID 70298080) is 3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride.
What is the SMILES notation for 3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride?
The canonical SMILES for 3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride is Cl.Cl.NC(=O)CCN1CCC(C2C=CC=CN2)CC1.
What is the InChIKey of 3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride?
The InChIKey is DXPDOLHFPWNPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O.2ClH/c14-13(17)6-10-16-8-4-11(5-9-16)12-3-1-2-7-15-12;;/h1-3,7,11-12,15H,4-6,8-10H2,(H2,14,17);2*1H.
What are the key properties of 3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride?
3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride has a molecular weight of 308.25 g/mol, XLogP of 1.46, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,2-dihydropyridin-2-yl)piperidin-1-yl]propanamide;dihydrochloride is sourced from PubChem (CID 70298080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).