C31H30N6O3S2 — CID 70298684
8-N-[(2-amino-5-methyl-5,6-dihydro-1,3-benzothiazol-6-yl)methyl]-3-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-2-thiophen-3-ylimidazo[1,2-a]pyridine-3,8-dicarboxamide (PubChem CID 70298684) has the molecular formula C31H30N6O3S2 and a molecular weight of 598.75 g/mol. Its IUPAC name is 8-N-[(2-amino-5-methyl-5,6-dihydro-1,3-benzothiazol-6-yl)methyl]-3-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-2-thiophen-3-ylimidazo[1,2-a]pyridine-3,8-dicarboxamide.
| Compound Name | 8-N-[(2-amino-5-methyl-5,6-dihydro-1,3-benzothiazol-6-yl)methyl]-3-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-2-thiophen-3-ylimidazo[1,2-a]pyridine-3,8-dicarboxamide |
|---|---|
| PubChem CID | 70298684 |
| Molecular Formula | C31H30N6O3S2 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | 8-N-[(2-amino-5-methyl-5,6-dihydro-1,3-benzothiazol-6-yl)methyl]-3-N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-2-thiophen-3-ylimidazo[1,2-a]pyridine-3,8-dicarboxamide |
| SMILES | CC1C=c2nc(N)sc2=CC1CNC(=O)c1cccn2c(C(=O)N[C@H](C)[C@@H](O)c3ccccc3)c(-c3ccsc3)nc12 |
| InChI | InChI=1S/C31H30N6O3S2/c1-17-13-23-24(42-31(32)35-23)14-21(17)15-33-29(39)22-9-6-11-37-26(25(36-28(22)37)20-10-12-41-16-20)30(40)34-18(2)27(38)19-7-4-3-5-8-19/h3-14,16-18,21,27,38H,15H2,1-2H3,(H2,32,35)(H,33,39)(H,34,40)/t17?,18-,21?,27-/m1/s1 |
| InChIKey | NEZDDGXTXXLCDQ-OWKOILTFSA-N |
| XLogP | 3.21 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |