About 2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol
2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol (PubChem CID 70299164) has the molecular formula C9H11N3OS
and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol |
| PubChem CID | 70299164 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol |
| SMILES | Cc1ncc(CC(O)c2nccs2)[nH]1 |
| InChI | InChI=1S/C9H11N3OS/c1-6-11-5-7(12-6)4-8(13)9-10-2-3-14-9/h2-3,5,8,13H,4H2,1H3,(H,11,12) |
| InChIKey | SZBAYNMRDSBFCN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol?
The IUPAC name of 2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol (CID 70299164) is 2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol.
What is the SMILES notation for 2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol?
The canonical SMILES for 2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol is Cc1ncc(CC(O)c2nccs2)[nH]1.
What is the InChIKey of 2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol?
The InChIKey is SZBAYNMRDSBFCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3OS/c1-6-11-5-7(12-6)4-8(13)9-10-2-3-14-9/h2-3,5,8,13H,4H2,1H3,(H,11,12).
What are the key properties of 2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol?
2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol has a molecular weight of 209.27 g/mol, XLogP of 1.45, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1H-imidazol-5-yl)-1-(1,3-thiazol-2-yl)ethanol is sourced from PubChem (CID 70299164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).