C18H24N2O4S — CID 70299655
(5S,7S,8Z)-20-methoxy-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(16),8,17,19-tetraen-4-one (PubChem CID 70299655) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is (5S,7S,8Z)-20-methoxy-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(16),8,17,19-tetraen-4-one.
| Compound Name | (5S,7S,8Z)-20-methoxy-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(16),8,17,19-tetraen-4-one |
|---|---|
| PubChem CID | 70299655 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (5S,7S,8Z)-20-methoxy-2,2-dioxo-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(16),8,17,19-tetraen-4-one |
| SMILES | COc1cccc2c1S(=O)(=O)NC(=O)[C@H]1C[C@H]1/C=C\CCCCCN2 |
| InChI | InChI=1S/C18H24N2O4S/c1-24-16-10-7-9-15-17(16)25(22,23)20-18(21)14-12-13(14)8-5-3-2-4-6-11-19-15/h5,7-10,13-14,19H,2-4,6,11-12H2,1H3,(H,20,21)/b8-5-/t13-,14+/m1/s1 |
| InChIKey | NWANSOZMDMSOIE-GMOCCLDISA-N |
| XLogP | 2.68 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|