C25H20BrNO3S — CID 7029973
(4aR,8aS)-6-bromo-3-[(2R)-2-(1,2-dihydroacenaphthylen-5-yl)-1,3-thiazolidine-3-carbonyl]-4a,8a-dihydrochromen-2-one (PubChem CID 7029973) has the molecular formula C25H20BrNO3S and a molecular weight of 494.41 g/mol. Its IUPAC name is (4aR,8aS)-6-bromo-3-[(2R)-2-(1,2-dihydroacenaphthylen-5-yl)-1,3-thiazolidine-3-carbonyl]-4a,8a-dihydrochromen-2-one.
| Compound Name | (4aR,8aS)-6-bromo-3-[(2R)-2-(1,2-dihydroacenaphthylen-5-yl)-1,3-thiazolidine-3-carbonyl]-4a,8a-dihydrochromen-2-one |
|---|---|
| PubChem CID | 7029973 |
| Molecular Formula | C25H20BrNO3S |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | (4aR,8aS)-6-bromo-3-[(2R)-2-(1,2-dihydroacenaphthylen-5-yl)-1,3-thiazolidine-3-carbonyl]-4a,8a-dihydrochromen-2-one |
| SMILES | O=C1O[C@H]2C=CC(Br)=C[C@H]2C=C1C(=O)N1CCS[C@@H]1c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C25H20BrNO3S/c26-17-7-9-21-16(12-17)13-20(25(29)30-21)23(28)27-10-11-31-24(27)19-8-6-15-5-4-14-2-1-3-18(19)22(14)15/h1-3,6-9,12-13,16,21,24H,4-5,10-11H2/t16-,21-,24+/m0/s1 |
| InChIKey | DQBJPQJPOVXEGN-LYAKXMMSSA-N |
| XLogP | 4.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|