C19H22F3N5O — CID 70299815
(2R)-5-(4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,11-trien-4-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)oxan-3-amine (PubChem CID 70299815) has the molecular formula C19H22F3N5O and a molecular weight of 393.41 g/mol. Its IUPAC name is (2R)-5-(4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,11-trien-4-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)oxan-3-amine.
| Compound Name | (2R)-5-(4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,11-trien-4-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)oxan-3-amine |
|---|---|
| PubChem CID | 70299815 |
| Molecular Formula | C19H22F3N5O |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (2R)-5-(4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,11-trien-4-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)oxan-3-amine |
| SMILES | NC1CC(N2Cc3nn4c(c3C2)N=CCC4)CO[C@@H]1C1CC(F)=C(F)C=C1F |
| InChI | InChI=1S/C19H22F3N5O/c20-13-6-15(22)14(21)5-11(13)18-16(23)4-10(9-28-18)26-7-12-17(8-26)25-27-3-1-2-24-19(12)27/h2,6,10-11,16,18H,1,3-5,7-9,23H2/t10?,11?,16?,18-/m1/s1 |
| InChIKey | ZHSQCQPDYJZBQM-HEOYPMRLSA-N |
| XLogP | 2.81 |
| TPSA | 68.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |