C33H52O5S — CID 70300198
[(9S,10R,13S,14R,17S)-1-acetyloxy-17-[1-(6-hydroxy-6-methylheptyl)sulfanylethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 70300198) has the molecular formula C33H52O5S and a molecular weight of 560.84 g/mol. Its IUPAC name is [(9S,10R,13S,14R,17S)-1-acetyloxy-17-[1-(6-hydroxy-6-methylheptyl)sulfanylethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(9S,10R,13S,14R,17S)-1-acetyloxy-17-[1-(6-hydroxy-6-methylheptyl)sulfanylethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 70300198 |
| Molecular Formula | C33H52O5S |
| Molecular Weight | 560.84 g/mol |
| Exact Mass | 560.35 |
| IUPAC Name | [(9S,10R,13S,14R,17S)-1-acetyloxy-17-[1-(6-hydroxy-6-methylheptyl)sulfanylethyl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC2=CC=C3[C@@H]4CC[C@H](C(C)SCCCCCC(C)(C)O)[C@@]4(C)CC[C@@H]3[C@@]2(C)C(OC(C)=O)C1 |
| InChI | InChI=1S/C33H52O5S/c1-21(39-18-10-8-9-16-31(4,5)36)27-13-14-28-26-12-11-24-19-25(37-22(2)34)20-30(38-23(3)35)33(24,7)29(26)15-17-32(27,28)6/h11-12,21,25,27-30,36H,8-10,13-20H2,1-7H3/t21?,25?,27-,28+,29+,30?,32-,33+/m1/s1 |
| InChIKey | XNEKOAROCHERFT-NQVUKWFZSA-N |
| XLogP | 7.41 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.84 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|