C22H23N5O2 — CID 70300494
2-N-[[6-(3-aminophenyl)-3-pyridinyl]methyl]-6-N-propan-2-ylpyridine-2,6-dicarboxamide (PubChem CID 70300494) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-N-[[6-(3-aminophenyl)-3-pyridinyl]methyl]-6-N-propan-2-ylpyridine-2,6-dicarboxamide.
| Compound Name | 2-N-[[6-(3-aminophenyl)-3-pyridinyl]methyl]-6-N-propan-2-ylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 70300494 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-N-[[6-(3-aminophenyl)-3-pyridinyl]methyl]-6-N-propan-2-ylpyridine-2,6-dicarboxamide |
| SMILES | CC(C)NC(=O)c1cccc(C(=O)NCc2ccc(-c3cccc(N)c3)nc2)n1 |
| InChI | InChI=1S/C22H23N5O2/c1-14(2)26-22(29)20-8-4-7-19(27-20)21(28)25-13-15-9-10-18(24-12-15)16-5-3-6-17(23)11-16/h3-12,14H,13,23H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | QRKWTXPTHGKROO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|