About 4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide
4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide (PubChem CID 70300652) has the molecular formula C17H31N3O4
and a molecular weight of 341.45 g/mol. Its IUPAC name is 4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide.
Molecular Properties
| Compound Name | 4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide |
| PubChem CID | 70300652 |
| Molecular Formula | C17H31N3O4 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | 4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide |
| SMILES | NC(=O)N1CCOCC1.O=C(O)C1(C2CCCCC2)CCNCC1 |
| InChI | InChI=1S/C12H21NO2.C5H10N2O2/c14-11(15)12(6-8-13-9-7-12)10-4-2-1-3-5-10;6-5(8)7-1-3-9-4-2-7/h10,13H,1-9H2,(H,14,15);1-4H2,(H2,6,8) |
| InChIKey | LWYAAIHKNYCBGJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide?
The IUPAC name of 4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide (CID 70300652) is 4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide.
What is the SMILES notation for 4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide?
The canonical SMILES for 4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide is NC(=O)N1CCOCC1.O=C(O)C1(C2CCCCC2)CCNCC1.
What is the InChIKey of 4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide?
The InChIKey is LWYAAIHKNYCBGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2.C5H10N2O2/c14-11(15)12(6-8-13-9-7-12)10-4-2-1-3-5-10;6-5(8)7-1-3-9-4-2-7/h10,13H,1-9H2,(H,14,15);1-4H2,(H2,6,8).
What are the key properties of 4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide?
4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide has a molecular weight of 341.45 g/mol, XLogP of 1.42, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylpiperidine-4-carboxylic acid;morpholine-4-carboxamide is sourced from PubChem (CID 70300652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).