About N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide
N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide (PubChem CID 703007) has the molecular formula C15H13N5O
and a molecular weight of 279.30 g/mol. Its IUPAC name is N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide.
Molecular Properties
| Compound Name | N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide |
| PubChem CID | 703007 |
| Molecular Formula | C15H13N5O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide |
| SMILES | Nc1nc(NC(=O)c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C15H13N5O/c16-14-18-15(17-13(21)11-7-3-1-4-8-11)19-20(14)12-9-5-2-6-10-12/h1-10H,(H3,16,17,18,19,21) |
| InChIKey | OMFMTXNGSUSPPF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide?
The IUPAC name of N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide (CID 703007) is N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide.
What is the SMILES notation for N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide?
The canonical SMILES for N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide is Nc1nc(NC(=O)c2ccccc2)nn1-c1ccccc1.
What is the InChIKey of N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide?
The InChIKey is OMFMTXNGSUSPPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N5O/c16-14-18-15(17-13(21)11-7-3-1-4-8-11)19-20(14)12-9-5-2-6-10-12/h1-10H,(H3,16,17,18,19,21).
What are the key properties of N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide?
N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide has a molecular weight of 279.30 g/mol, XLogP of 2.10, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)benzamide is sourced from PubChem (CID 703007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).