About 2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid
2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid (PubChem CID 703012) has the molecular formula C12H17BrO2
and a molecular weight of 273.17 g/mol. Its IUPAC name is 2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid.
Molecular Properties
| Compound Name | 2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid |
| PubChem CID | 703012 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid |
| SMILES | O=C(O)CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C12H17BrO2/c13-12-4-8-1-9(5-12)3-11(2-8,7-12)6-10(14)15/h8-9H,1-7H2,(H,14,15)/t8-,9+,11?,12? |
| InChIKey | HFGLWCBEPPFDDJ-LRSDLPTKSA-N |
| XLogP | 3.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid?
The IUPAC name of 2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid (CID 703012) is 2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid.
What is the SMILES notation for 2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid?
The canonical SMILES for 2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid is O=C(O)CC12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2.
What is the InChIKey of 2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid?
The InChIKey is HFGLWCBEPPFDDJ-LRSDLPTKSA-N. The full InChI is InChI=1S/C12H17BrO2/c13-12-4-8-1-9(5-12)3-11(2-8,7-12)6-10(14)15/h8-9H,1-7H2,(H,14,15)/t8-,9+,11?,12?.
What are the key properties of 2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid?
2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid has a molecular weight of 273.17 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5S,7R)-3-bromo-1-adamantyl]acetic acid is sourced from PubChem (CID 703012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).