About methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate
methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate (PubChem CID 70301463) has the molecular formula C15H18O7
and a molecular weight of 310.30 g/mol. Its IUPAC name is methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 70301463 |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate |
| SMILES | C=CCOC1C(OC(C)=O)=CC(C(=O)OC)=CC1OC(C)=O |
| InChI | InChI=1S/C15H18O7/c1-5-6-20-14-12(21-9(2)16)7-11(15(18)19-4)8-13(14)22-10(3)17/h5,7-8,12,14H,1,6H2,2-4H3 |
| InChIKey | MKXMXCXZTNPATK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate (CID 70301463) is methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate is C=CCOC1C(OC(C)=O)=CC(C(=O)OC)=CC1OC(C)=O.
What is the InChIKey of methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate?
The InChIKey is MKXMXCXZTNPATK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O7/c1-5-6-20-14-12(21-9(2)16)7-11(15(18)19-4)8-13(14)22-10(3)17/h5,7-8,12,14H,1,6H2,2-4H3.
What are the key properties of methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate?
methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate has a molecular weight of 310.30 g/mol, XLogP of 1.05, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-diacetyloxy-4-prop-2-enoxycyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 70301463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).