C12H15NO3 — CID 70301586
prop-1-en-2-yl N-[[4-(hydroxymethyl)phenyl]methyl]carbamate (PubChem CID 70301586) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is prop-1-en-2-yl N-[[4-(hydroxymethyl)phenyl]methyl]carbamate.
| Compound Name | prop-1-en-2-yl N-[[4-(hydroxymethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 70301586 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | prop-1-en-2-yl N-[[4-(hydroxymethyl)phenyl]methyl]carbamate |
| SMILES | C=C(C)OC(=O)NCc1ccc(CO)cc1 |
| InChI | InChI=1S/C12H15NO3/c1-9(2)16-12(15)13-7-10-3-5-11(8-14)6-4-10/h3-6,14H,1,7-8H2,2H3,(H,13,15) |
| InChIKey | FHOQQPOHWWBBKR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|