C20H23F2N5 — CID 70301847
(2R)-2-(2,5-difluorocyclohexa-2,4-dien-1-yl)-5-(4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)cyclohexan-1-amine (PubChem CID 70301847) has the molecular formula C20H23F2N5 and a molecular weight of 371.44 g/mol. Its IUPAC name is (2R)-2-(2,5-difluorocyclohexa-2,4-dien-1-yl)-5-(4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)cyclohexan-1-amine.
| Compound Name | (2R)-2-(2,5-difluorocyclohexa-2,4-dien-1-yl)-5-(4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 70301847 |
| Molecular Formula | C20H23F2N5 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (2R)-2-(2,5-difluorocyclohexa-2,4-dien-1-yl)-5-(4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-4-yl)cyclohexan-1-amine |
| SMILES | NC1CC(N2Cc3nn4cccnc4c3C2)CC[C@@H]1C1CC(F)=CC=C1F |
| InChI | InChI=1S/C20H23F2N5/c21-12-2-5-17(22)15(8-12)14-4-3-13(9-18(14)23)26-10-16-19(11-26)25-27-7-1-6-24-20(16)27/h1-2,5-7,13-15,18H,3-4,8-11,23H2/t13?,14-,15?,18?/m1/s1 |
| InChIKey | NKKQQCDEUNOXEA-GGDJBSTQSA-N |
| XLogP | 3.27 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |