C18H20N2O3S — CID 70301935
(5S,7S,8Z)-2,2-dioxo-2λ6-thia-3,14-diazatetracyclo[12.6.1.05,7.017,21]henicosa-1(20),8,15,17(21),18-pentaen-4-one (PubChem CID 70301935) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is (5S,7S,8Z)-2,2-dioxo-2λ6-thia-3,14-diazatetracyclo[12.6.1.05,7.017,21]henicosa-1(20),8,15,17(21),18-pentaen-4-one.
| Compound Name | (5S,7S,8Z)-2,2-dioxo-2λ6-thia-3,14-diazatetracyclo[12.6.1.05,7.017,21]henicosa-1(20),8,15,17(21),18-pentaen-4-one |
|---|---|
| PubChem CID | 70301935 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (5S,7S,8Z)-2,2-dioxo-2λ6-thia-3,14-diazatetracyclo[12.6.1.05,7.017,21]henicosa-1(20),8,15,17(21),18-pentaen-4-one |
| SMILES | O=C1NS(=O)(=O)c2cccc3ccn(c23)CCCC/C=C\[C@@H]2C[C@H]12 |
| InChI | InChI=1S/C18H20N2O3S/c21-18-15-12-14(15)6-3-1-2-4-10-20-11-9-13-7-5-8-16(17(13)20)24(22,23)19-18/h3,5-9,11,14-15H,1-2,4,10,12H2,(H,19,21)/b6-3-/t14-,15+/m1/s1 |
| InChIKey | AJMOYYGQLVHZGI-IDQBRBTGSA-N |
| XLogP | 2.82 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|