About 2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride
2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride (PubChem CID 70301959) has the molecular formula C10H12ClIN2
and a molecular weight of 322.58 g/mol. Its IUPAC name is 2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride.
Molecular Properties
| Compound Name | 2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride |
| PubChem CID | 70301959 |
| Molecular Formula | C10H12ClIN2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | 2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride |
| SMILES | Cc1ccc(I)cc1C1=NCCN1.Cl |
| InChI | InChI=1S/C10H11IN2.ClH/c1-7-2-3-8(11)6-9(7)10-12-4-5-13-10;/h2-3,6H,4-5H2,1H3,(H,12,13);1H |
| InChIKey | ULJUYHANKFRDPV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride?
The IUPAC name of 2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride (CID 70301959) is 2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride.
What is the SMILES notation for 2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride?
The canonical SMILES for 2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride is Cc1ccc(I)cc1C1=NCCN1.Cl.
What is the InChIKey of 2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride?
The InChIKey is ULJUYHANKFRDPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11IN2.ClH/c1-7-2-3-8(11)6-9(7)10-12-4-5-13-10;/h2-3,6H,4-5H2,1H3,(H,12,13);1H.
What are the key properties of 2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride?
2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride has a molecular weight of 322.58 g/mol, XLogP of 2.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-iodo-2-methylphenyl)-4,5-dihydro-1H-imidazole;hydrochloride is sourced from PubChem (CID 70301959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).