C21H22N2O6S — CID 70302106
(E)-3-[4-[2-oxo-2-[4-(thiophen-2-ylmethoxycarbonyl)piperazin-1-yl]ethoxy]phenyl]prop-2-enoic acid (PubChem CID 70302106) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is (E)-3-[4-[2-oxo-2-[4-(thiophen-2-ylmethoxycarbonyl)piperazin-1-yl]ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-oxo-2-[4-(thiophen-2-ylmethoxycarbonyl)piperazin-1-yl]ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70302106 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (E)-3-[4-[2-oxo-2-[4-(thiophen-2-ylmethoxycarbonyl)piperazin-1-yl]ethoxy]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OCC(=O)N2CCN(C(=O)OCc3cccs3)CC2)cc1 |
| InChI | InChI=1S/C21H22N2O6S/c24-19(15-28-17-6-3-16(4-7-17)5-8-20(25)26)22-9-11-23(12-10-22)21(27)29-14-18-2-1-13-30-18/h1-8,13H,9-12,14-15H2,(H,25,26)/b8-5+ |
| InChIKey | JLURGHHEXMRRAE-VMPITWQZSA-N |
| XLogP | 2.71 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|