C16H20N2O4S — CID 70302120
(5S,7S,8Z)-2,2-dioxo-12-oxa-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(20),8,16,18-tetraen-4-one (PubChem CID 70302120) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is (5S,7S,8Z)-2,2-dioxo-12-oxa-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(20),8,16,18-tetraen-4-one.
| Compound Name | (5S,7S,8Z)-2,2-dioxo-12-oxa-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(20),8,16,18-tetraen-4-one |
|---|---|
| PubChem CID | 70302120 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (5S,7S,8Z)-2,2-dioxo-12-oxa-2λ6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(20),8,16,18-tetraen-4-one |
| SMILES | O=C1NS(=O)(=O)c2ccccc2NCCOCC/C=C\[C@@H]2C[C@H]12 |
| InChI | InChI=1S/C16H20N2O4S/c19-16-13-11-12(13)5-3-4-9-22-10-8-17-14-6-1-2-7-15(14)23(20,21)18-16/h1-3,5-7,12-13,17H,4,8-11H2,(H,18,19)/b5-3-/t12-,13+/m1/s1 |
| InChIKey | QZFXZYICVCZCDL-NZTAEXDXSA-N |
| XLogP | 1.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|