C28H33FN4O4 — CID 70302278
(5R,7S)-1-(3-fluorophenyl)-7-methyl-3-(1,2-oxazol-3-ylmethyl)-8-[(3-propan-2-yloxycyclohexa-1,5-dien-1-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 70302278) has the molecular formula C28H33FN4O4 and a molecular weight of 508.59 g/mol. Its IUPAC name is (5R,7S)-1-(3-fluorophenyl)-7-methyl-3-(1,2-oxazol-3-ylmethyl)-8-[(3-propan-2-yloxycyclohexa-1,5-dien-1-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,7S)-1-(3-fluorophenyl)-7-methyl-3-(1,2-oxazol-3-ylmethyl)-8-[(3-propan-2-yloxycyclohexa-1,5-dien-1-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 70302278 |
| Molecular Formula | C28H33FN4O4 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | (5R,7S)-1-(3-fluorophenyl)-7-methyl-3-(1,2-oxazol-3-ylmethyl)-8-[(3-propan-2-yloxycyclohexa-1,5-dien-1-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)OC1C=C(CN2CC[C@@]3(C[C@@H]2C)C(=O)N(Cc2ccon2)C(=O)N3c2cccc(F)c2)C=CC1 |
| InChI | InChI=1S/C28H33FN4O4/c1-19(2)37-25-9-4-6-21(14-25)17-31-12-11-28(16-20(31)3)26(34)32(18-23-10-13-36-30-23)27(35)33(28)24-8-5-7-22(29)15-24/h4-8,10,13-15,19-20,25H,9,11-12,16-18H2,1-3H3/t20-,25?,28+/m0/s1 |
| InChIKey | NGTGFXCKAVSIAB-BZSWLZEGSA-N |
| XLogP | 4.69 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|