About trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol
trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol (PubChem CID 70302333) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol |
| PubChem CID | 70302333 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol |
| SMILES | C=CC[C@]1(C)CCC[C@H]1O |
| InChI | InChI=1S/C9H16O/c1-3-6-9(2)7-4-5-8(9)10/h3,8,10H,1,4-7H2,2H3/t8-,9-/m1/s1 |
| InChIKey | LYNKUKIMWGBAMJ-RKDXNWHRSA-N |
| XLogP | 2.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol?
The IUPAC name of trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol (CID 70302333) is trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol.
What is the SMILES notation for trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol?
The canonical SMILES for trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol is C=CC[C@]1(C)CCC[C@H]1O.
What is the InChIKey of trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol?
The InChIKey is LYNKUKIMWGBAMJ-RKDXNWHRSA-N. The full InChI is InChI=1S/C9H16O/c1-3-6-9(2)7-4-5-8(9)10/h3,8,10H,1,4-7H2,2H3/t8-,9-/m1/s1.
What are the key properties of trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol?
trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol has a molecular weight of 140.23 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2S)-2-methyl-2-prop-2-enylcyclopentan-1-ol is sourced from PubChem (CID 70302333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).