C12H24N2 — CID 70302406
3-(2,2,6,6-tetramethylpiperidin-3-yl)prop-1-en-1-amine (PubChem CID 70302406) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 3-(2,2,6,6-tetramethylpiperidin-3-yl)prop-1-en-1-amine.
| Compound Name | 3-(2,2,6,6-tetramethylpiperidin-3-yl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 70302406 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 3-(2,2,6,6-tetramethylpiperidin-3-yl)prop-1-en-1-amine |
| SMILES | CC1(C)CCC(CC=CN)C(C)(C)N1 |
| InChI | InChI=1S/C12H24N2/c1-11(2)8-7-10(6-5-9-13)12(3,4)14-11/h5,9-10,14H,6-8,13H2,1-4H3 |
| InChIKey | JZBDZBPLRQPLQU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |