About 5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine
5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 70302520) has the molecular formula C9H9FO2
and a molecular weight of 168.17 g/mol. Its IUPAC name is 5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine.
Molecular Properties
| Compound Name | 5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine |
| PubChem CID | 70302520 |
| Molecular Formula | C9H9FO2 |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | CC1COc2c(F)cccc2O1 |
| InChI | InChI=1S/C9H9FO2/c1-6-5-11-9-7(10)3-2-4-8(9)12-6/h2-4,6H,5H2,1H3 |
| InChIKey | DLDIXAXUJSTMQE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine?
The IUPAC name of 5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine (CID 70302520) is 5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine.
What is the SMILES notation for 5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine?
The canonical SMILES for 5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine is CC1COc2c(F)cccc2O1.
What is the InChIKey of 5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine?
The InChIKey is DLDIXAXUJSTMQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FO2/c1-6-5-11-9-7(10)3-2-4-8(9)12-6/h2-4,6H,5H2,1H3.
What are the key properties of 5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine?
5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine has a molecular weight of 168.17 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methyl-2,3-dihydro-1,4-benzodioxine is sourced from PubChem (CID 70302520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).