C23H29NO5 — CID 70302538
(E)-but-2-enedioic acid;1-[(1R,2S,3S)-3-[4-[(E)-prop-1-enyl]phenyl]-8-azabicyclo[3.2.1]octan-2-yl]propan-1-one (PubChem CID 70302538) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[(1R,2S,3S)-3-[4-[(E)-prop-1-enyl]phenyl]-8-azabicyclo[3.2.1]octan-2-yl]propan-1-one.
| Compound Name | (E)-but-2-enedioic acid;1-[(1R,2S,3S)-3-[4-[(E)-prop-1-enyl]phenyl]-8-azabicyclo[3.2.1]octan-2-yl]propan-1-one |
|---|---|
| PubChem CID | 70302538 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[(1R,2S,3S)-3-[4-[(E)-prop-1-enyl]phenyl]-8-azabicyclo[3.2.1]octan-2-yl]propan-1-one |
| SMILES | C/C=C/c1ccc([C@H]2CC3CC[C@@H](N3)[C@H]2C(=O)CC)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H25NO.C4H4O4/c1-3-5-13-6-8-14(9-7-13)16-12-15-10-11-17(20-15)19(16)18(21)4-2;5-3(6)1-2-4(7)8/h3,5-9,15-17,19-20H,4,10-12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b5-3+;2-1+/t15?,16-,17-,19+;/m1./s1 |
| InChIKey | VVGGUKLMKGGKIU-VDGCFQBGSA-N |
| XLogP | 3.63 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|