About 2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile
2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile (PubChem CID 70302737) has the molecular formula C28H30N2
and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile.
Molecular Properties
| Compound Name | 2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile |
| PubChem CID | 70302737 |
| Molecular Formula | C28H30N2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile |
| SMILES | CN(Cc1ccccc1)C1CCCC(C(C#N)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H30N2/c1-30(21-23-12-5-2-6-13-23)27-19-11-18-26(20-27)28(22-29,24-14-7-3-8-15-24)25-16-9-4-10-17-25/h2-10,12-17,26-27H,11,18-21H2,1H3 |
| InChIKey | VJRSJBVVRMVTOV-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile?
The IUPAC name of 2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile (CID 70302737) is 2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile.
What is the SMILES notation for 2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile?
The canonical SMILES for 2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile is CN(Cc1ccccc1)C1CCCC(C(C#N)(c2ccccc2)c2ccccc2)C1.
What is the InChIKey of 2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile?
The InChIKey is VJRSJBVVRMVTOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N2/c1-30(21-23-12-5-2-6-13-23)27-19-11-18-26(20-27)28(22-29,24-14-7-3-8-15-24)25-16-9-4-10-17-25/h2-10,12-17,26-27H,11,18-21H2,1H3.
What are the key properties of 2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile?
2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile has a molecular weight of 394.56 g/mol, XLogP of 6.19, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[benzyl(methyl)amino]cyclohexyl]-2,2-diphenylacetonitrile is sourced from PubChem (CID 70302737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).