C29H31BrN2O3 — CID 70302814
2-(1,3-benzodioxol-5-ylmethyl)-4-(4-bromophenyl)-1-cyclohexyl-1,3a,4,6,7,8-hexahydropyrrolo[3,4-a]pyrrolizin-3-one (PubChem CID 70302814) has the molecular formula C29H31BrN2O3 and a molecular weight of 535.48 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-4-(4-bromophenyl)-1-cyclohexyl-1,3a,4,6,7,8-hexahydropyrrolo[3,4-a]pyrrolizin-3-one.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-4-(4-bromophenyl)-1-cyclohexyl-1,3a,4,6,7,8-hexahydropyrrolo[3,4-a]pyrrolizin-3-one |
|---|---|
| PubChem CID | 70302814 |
| Molecular Formula | C29H31BrN2O3 |
| Molecular Weight | 535.48 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-4-(4-bromophenyl)-1-cyclohexyl-1,3a,4,6,7,8-hexahydropyrrolo[3,4-a]pyrrolizin-3-one |
| SMILES | O=C1C2C(=C3CCCN3C2c2ccc(Br)cc2)C(C2CCCCC2)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H31BrN2O3/c30-21-11-9-20(10-12-21)28-26-25(22-7-4-14-31(22)28)27(19-5-2-1-3-6-19)32(29(26)33)16-18-8-13-23-24(15-18)35-17-34-23/h8-13,15,19,26-28H,1-7,14,16-17H2 |
| InChIKey | RUSRXDMQWQPKDQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.48 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |