C8H10N6 — CID 70303180
4-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-12-amine (PubChem CID 70303180) has the molecular formula C8H10N6 and a molecular weight of 190.21 g/mol. Its IUPAC name is 4-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-12-amine.
| Compound Name | 4-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-12-amine |
|---|---|
| PubChem CID | 70303180 |
| Molecular Formula | C8H10N6 |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 4-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-12-amine |
| SMILES | CN1Cc2cnc3nnc(N)n3c2C1 |
| InChI | InChI=1S/C8H10N6/c1-13-3-5-2-10-8-12-11-7(9)14(8)6(5)4-13/h2H,3-4H2,1H3,(H2,9,11) |
| InChIKey | QIKWWCPXYIQVHP-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |