C41H46N4O4 — CID 70303218
N-[2-(5-phenylmethoxy-1H-indol-3-yl)ethyl]butanamide;N-[2-(5-phenylmethoxy-1H-indol-3-yl)ethyl]propanamide (PubChem CID 70303218) has the molecular formula C41H46N4O4 and a molecular weight of 658.84 g/mol. Its IUPAC name is N-[2-(5-phenylmethoxy-1H-indol-3-yl)ethyl]butanamide;N-[2-(5-phenylmethoxy-1H-indol-3-yl)ethyl]propanamide.
| Compound Name | N-[2-(5-phenylmethoxy-1H-indol-3-yl)ethyl]butanamide;N-[2-(5-phenylmethoxy-1H-indol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 70303218 |
| Molecular Formula | C41H46N4O4 |
| Molecular Weight | 658.84 g/mol |
| Exact Mass | 658.35 |
| IUPAC Name | N-[2-(5-phenylmethoxy-1H-indol-3-yl)ethyl]butanamide;N-[2-(5-phenylmethoxy-1H-indol-3-yl)ethyl]propanamide |
| SMILES | CCC(=O)NCCc1c[nH]c2ccc(OCc3ccccc3)cc12.CCCC(=O)NCCc1c[nH]c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C21H24N2O2.C20H22N2O2/c1-2-6-21(24)22-12-11-17-14-23-20-10-9-18(13-19(17)20)25-15-16-7-4-3-5-8-16;1-2-20(23)21-11-10-16-13-22-19-9-8-17(12-18(16)19)24-14-15-6-4-3-5-7-15/h3-5,7-10,13-14,23H,2,6,11-12,15H2,1H3,(H,22,24);3-9,12-13,22H,2,10-11,14H2,1H3,(H,21,23) |
| InChIKey | GKJXFRTYVYGCJH-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 108.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.84 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |