About 4,5-difluorocyclohexa-3,5-diene-1,2-diimine
4,5-difluorocyclohexa-3,5-diene-1,2-diimine (PubChem CID 70303232) has the molecular formula C6H4F2N2
and a molecular weight of 142.11 g/mol. Its IUPAC name is 4,5-difluorocyclohexa-3,5-diene-1,2-diimine.
Molecular Properties
| Compound Name | 4,5-difluorocyclohexa-3,5-diene-1,2-diimine |
| PubChem CID | 70303232 |
| Molecular Formula | C6H4F2N2 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 4,5-difluorocyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1\C=C(F)C(F)=C\C1=N/[H] |
| InChI | InChI=1S/C6H4F2N2/c7-3-1-5(9)6(10)2-4(3)8/h1-2,9-10H/b9-5+,10-6+ |
| InChIKey | ODDMXWPSFCZJGL-NXZHAISVSA-N |
| XLogP | 1.75 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4,5-difluorocyclohexa-3,5-diene-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-difluorocyclohexa-3,5-diene-1,2-diimine?
The IUPAC name of 4,5-difluorocyclohexa-3,5-diene-1,2-diimine (CID 70303232) is 4,5-difluorocyclohexa-3,5-diene-1,2-diimine.
What is the SMILES notation for 4,5-difluorocyclohexa-3,5-diene-1,2-diimine?
The canonical SMILES for 4,5-difluorocyclohexa-3,5-diene-1,2-diimine is [H]/N=C1\C=C(F)C(F)=C\C1=N/[H].
What is the InChIKey of 4,5-difluorocyclohexa-3,5-diene-1,2-diimine?
The InChIKey is ODDMXWPSFCZJGL-NXZHAISVSA-N. The full InChI is InChI=1S/C6H4F2N2/c7-3-1-5(9)6(10)2-4(3)8/h1-2,9-10H/b9-5+,10-6+.
What are the key properties of 4,5-difluorocyclohexa-3,5-diene-1,2-diimine?
4,5-difluorocyclohexa-3,5-diene-1,2-diimine has a molecular weight of 142.11 g/mol, XLogP of 1.75, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-difluorocyclohexa-3,5-diene-1,2-diimine is sourced from PubChem (CID 70303232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).