About 3-(oxan-3-yl)propane-1,2-diamine
3-(oxan-3-yl)propane-1,2-diamine (PubChem CID 70303236) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is 3-(oxan-3-yl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 3-(oxan-3-yl)propane-1,2-diamine |
| PubChem CID | 70303236 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 3-(oxan-3-yl)propane-1,2-diamine |
| SMILES | NCC(N)CC1CCCOC1 |
| InChI | InChI=1S/C8H18N2O/c9-5-8(10)4-7-2-1-3-11-6-7/h7-8H,1-6,9-10H2 |
| InChIKey | RDQTUTUPODRYBQ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(oxan-3-yl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxan-3-yl)propane-1,2-diamine?
The IUPAC name of 3-(oxan-3-yl)propane-1,2-diamine (CID 70303236) is 3-(oxan-3-yl)propane-1,2-diamine.
What is the SMILES notation for 3-(oxan-3-yl)propane-1,2-diamine?
The canonical SMILES for 3-(oxan-3-yl)propane-1,2-diamine is NCC(N)CC1CCCOC1.
What is the InChIKey of 3-(oxan-3-yl)propane-1,2-diamine?
The InChIKey is RDQTUTUPODRYBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c9-5-8(10)4-7-2-1-3-11-6-7/h7-8H,1-6,9-10H2.
What are the key properties of 3-(oxan-3-yl)propane-1,2-diamine?
3-(oxan-3-yl)propane-1,2-diamine has a molecular weight of 158.24 g/mol, XLogP of 0.09, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxan-3-yl)propane-1,2-diamine is sourced from PubChem (CID 70303236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).