C14H24N2O2 — CID 70303859
(7R,8S)-2,8-diamino-8-phenyloctane-1,7-diol (PubChem CID 70303859) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (7R,8S)-2,8-diamino-8-phenyloctane-1,7-diol.
| Compound Name | (7R,8S)-2,8-diamino-8-phenyloctane-1,7-diol |
|---|---|
| PubChem CID | 70303859 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (7R,8S)-2,8-diamino-8-phenyloctane-1,7-diol |
| SMILES | NC(CO)CCCC[C@@H](O)[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C14H24N2O2/c15-12(10-17)8-4-5-9-13(18)14(16)11-6-2-1-3-7-11/h1-3,6-7,12-14,17-18H,4-5,8-10,15-16H2/t12?,13-,14+/m1/s1 |
| InChIKey | RXSZYCWLRUUKPO-IUZLNWEFSA-N |
| XLogP | 0.93 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|