C11H11N3O2S — CID 70304157
methyl 2-[4-(1,2,4-thiadiazol-3-ylamino)phenyl]acetate (PubChem CID 70304157) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is methyl 2-[4-(1,2,4-thiadiazol-3-ylamino)phenyl]acetate.
| Compound Name | methyl 2-[4-(1,2,4-thiadiazol-3-ylamino)phenyl]acetate |
|---|---|
| PubChem CID | 70304157 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | methyl 2-[4-(1,2,4-thiadiazol-3-ylamino)phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(Nc2ncsn2)cc1 |
| InChI | InChI=1S/C11H11N3O2S/c1-16-10(15)6-8-2-4-9(5-3-8)13-11-12-7-17-14-11/h2-5,7H,6H2,1H3,(H,13,14) |
| InChIKey | SXRNZRILDWJCGD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |