About (2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one
(2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one (PubChem CID 70304207) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one.
Molecular Properties
| Compound Name | (2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one |
| PubChem CID | 70304207 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one |
| SMILES | C=C1CCN(C(=O)[C@@H](C)CC(C)C)CC1 |
| InChI | InChI=1S/C13H23NO/c1-10(2)9-12(4)13(15)14-7-5-11(3)6-8-14/h10,12H,3,5-9H2,1-2,4H3/t12-/m0/s1 |
| InChIKey | LBSRIMICXMIRPQ-LBPRGKRZSA-N |
| XLogP | 2.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one?
The IUPAC name of (2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one (CID 70304207) is (2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one.
What is the SMILES notation for (2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one?
The canonical SMILES for (2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one is C=C1CCN(C(=O)[C@@H](C)CC(C)C)CC1.
What is the InChIKey of (2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one?
The InChIKey is LBSRIMICXMIRPQ-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H23NO/c1-10(2)9-12(4)13(15)14-7-5-11(3)6-8-14/h10,12H,3,5-9H2,1-2,4H3/t12-/m0/s1.
What are the key properties of (2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one?
(2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one has a molecular weight of 209.33 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,4-dimethyl-1-(4-methylidenepiperidin-1-yl)pentan-1-one is sourced from PubChem (CID 70304207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).