C21H24F3N5 — CID 70304355
(2R)-5-(11-methyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-5-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)cyclohexan-1-amine (PubChem CID 70304355) has the molecular formula C21H24F3N5 and a molecular weight of 403.45 g/mol. Its IUPAC name is (2R)-5-(11-methyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-5-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)cyclohexan-1-amine.
| Compound Name | (2R)-5-(11-methyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-5-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 70304355 |
| Molecular Formula | C21H24F3N5 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (2R)-5-(11-methyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-5-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)cyclohexan-1-amine |
| SMILES | Cc1cc2nc3c(cn2n1)CN(C1CC[C@H](C2CC(F)=C(F)C=C2F)C(N)C1)C3 |
| InChI | InChI=1S/C21H24F3N5/c1-11-4-21-26-20-10-28(8-12(20)9-29(21)27-11)13-2-3-14(19(25)5-13)15-6-17(23)18(24)7-16(15)22/h4,7,9,13-15,19H,2-3,5-6,8,10,25H2,1H3/t13?,14-,15?,19?/m1/s1 |
| InChIKey | JJHKIFWDSVLKHV-NESBLYBOSA-N |
| XLogP | 3.87 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |