About bis(1-tert-butyl-1-methylurea);toluene
bis(1-tert-butyl-1-methylurea);toluene (PubChem CID 70304434) has the molecular formula C19H36N4O2
and a molecular weight of 352.52 g/mol. Its IUPAC name is bis(1-tert-butyl-1-methylurea);toluene.
Molecular Properties
| Compound Name | bis(1-tert-butyl-1-methylurea);toluene |
| PubChem CID | 70304434 |
| Molecular Formula | C19H36N4O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | bis(1-tert-butyl-1-methylurea);toluene |
| SMILES | CN(C(N)=O)C(C)(C)C.CN(C(N)=O)C(C)(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C7H8.2C6H14N2O/c1-7-5-3-2-4-6-7;2*1-6(2,3)8(4)5(7)9/h2-6H,1H3;2*1-4H3,(H2,7,9) |
| InChIKey | HXMUFAKDIBCXRH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(1-tert-butyl-1-methylurea);toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-tert-butyl-1-methylurea);toluene?
The IUPAC name of bis(1-tert-butyl-1-methylurea);toluene (CID 70304434) is bis(1-tert-butyl-1-methylurea);toluene.
What is the SMILES notation for bis(1-tert-butyl-1-methylurea);toluene?
The canonical SMILES for bis(1-tert-butyl-1-methylurea);toluene is CN(C(N)=O)C(C)(C)C.CN(C(N)=O)C(C)(C)C.Cc1ccccc1.
What is the InChIKey of bis(1-tert-butyl-1-methylurea);toluene?
The InChIKey is HXMUFAKDIBCXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.2C6H14N2O/c1-7-5-3-2-4-6-7;2*1-6(2,3)8(4)5(7)9/h2-6H,1H3;2*1-4H3,(H2,7,9).
What are the key properties of bis(1-tert-butyl-1-methylurea);toluene?
bis(1-tert-butyl-1-methylurea);toluene has a molecular weight of 352.52 g/mol, XLogP of 3.59, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-tert-butyl-1-methylurea);toluene is sourced from PubChem (CID 70304434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).