C23H32O9 — CID 70304779
(E)-3-hydroxy-6-[6-methoxy-4-(2-methoxyethoxymethoxy)-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-2,2,4-trimethylhex-4-enoic acid (PubChem CID 70304779) has the molecular formula C23H32O9 and a molecular weight of 452.50 g/mol. Its IUPAC name is (E)-3-hydroxy-6-[6-methoxy-4-(2-methoxyethoxymethoxy)-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-2,2,4-trimethylhex-4-enoic acid.
| Compound Name | (E)-3-hydroxy-6-[6-methoxy-4-(2-methoxyethoxymethoxy)-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-2,2,4-trimethylhex-4-enoic acid |
|---|---|
| PubChem CID | 70304779 |
| Molecular Formula | C23H32O9 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (E)-3-hydroxy-6-[6-methoxy-4-(2-methoxyethoxymethoxy)-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-2,2,4-trimethylhex-4-enoic acid |
| SMILES | COCCOCOc1c(C/C=C(\C)C(O)C(C)(C)C(=O)O)c(OC)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C23H32O9/c1-13(20(24)23(3,4)22(26)27)7-8-15-18(29-6)14(2)16-11-31-21(25)17(16)19(15)32-12-30-10-9-28-5/h7,20,24H,8-12H2,1-6H3,(H,26,27)/b13-7+ |
| InChIKey | QZUBNYDHRPUUFP-NTUHNPAUSA-N |
| XLogP | 2.63 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|