C20H23F2N5O — CID 70305116
(2R)-2-(2,5-difluorocyclohexa-2,4-dien-1-yl)-5-(11-methyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-5-yl)oxan-3-amine (PubChem CID 70305116) has the molecular formula C20H23F2N5O and a molecular weight of 387.43 g/mol. Its IUPAC name is (2R)-2-(2,5-difluorocyclohexa-2,4-dien-1-yl)-5-(11-methyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-5-yl)oxan-3-amine.
| Compound Name | (2R)-2-(2,5-difluorocyclohexa-2,4-dien-1-yl)-5-(11-methyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-5-yl)oxan-3-amine |
|---|---|
| PubChem CID | 70305116 |
| Molecular Formula | C20H23F2N5O |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (2R)-2-(2,5-difluorocyclohexa-2,4-dien-1-yl)-5-(11-methyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-5-yl)oxan-3-amine |
| SMILES | Cc1cc2nc3c(cn2n1)CN(C1CO[C@H](C2CC(F)=CC=C2F)C(N)C1)C3 |
| InChI | InChI=1S/C20H23F2N5O/c1-11-4-19-24-18-9-26(7-12(18)8-27(19)25-11)14-6-17(23)20(28-10-14)15-5-13(21)2-3-16(15)22/h2-4,8,14-15,17,20H,5-7,9-10,23H2,1H3/t14?,15?,17?,20-/m1/s1 |
| InChIKey | AAENPMDXXNMILX-IDQKJFIUSA-N |
| XLogP | 2.56 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |