C10H11FO — CID 70305231
6-fluoro-4-methylidene-2,3,4a,8a-tetrahydrochromene (PubChem CID 70305231) has the molecular formula C10H11FO and a molecular weight of 166.19 g/mol. Its IUPAC name is 6-fluoro-4-methylidene-2,3,4a,8a-tetrahydrochromene.
| Compound Name | 6-fluoro-4-methylidene-2,3,4a,8a-tetrahydrochromene |
|---|---|
| PubChem CID | 70305231 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 6-fluoro-4-methylidene-2,3,4a,8a-tetrahydrochromene |
| SMILES | C=C1CCOC2C=CC(F)=CC12 |
| InChI | InChI=1S/C10H11FO/c1-7-4-5-12-10-3-2-8(11)6-9(7)10/h2-3,6,9-10H,1,4-5H2 |
| InChIKey | OXQMHEJBYOSJAY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|